C15H22N2 — CID 101109605
1,3-dimethyl-5-phenyl-2-prop-2-enyl-1,3-diazinane (PubChem CID 101109605) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 1,3-dimethyl-5-phenyl-2-prop-2-enyl-1,3-diazinane.
| Compound Name | 1,3-dimethyl-5-phenyl-2-prop-2-enyl-1,3-diazinane |
|---|---|
| PubChem CID | 101109605 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1,3-dimethyl-5-phenyl-2-prop-2-enyl-1,3-diazinane |
| SMILES | C=CCC1N(C)CC(c2ccccc2)CN1C |
| InChI | InChI=1S/C15H22N2/c1-4-8-15-16(2)11-14(12-17(15)3)13-9-6-5-7-10-13/h4-7,9-10,14-15H,1,8,11-12H2,2-3H3 |
| InChIKey | FDVMYQLVRYQZDH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|