C22H24O2 — CID 11141751
(2R,3R,5R,6R)-2,3-diphenyl-5,6-bis(prop-2-enyl)-1,4-dioxane (PubChem CID 11141751) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is (2R,3R,5R,6R)-2,3-diphenyl-5,6-bis(prop-2-enyl)-1,4-dioxane.
| Compound Name | (2R,3R,5R,6R)-2,3-diphenyl-5,6-bis(prop-2-enyl)-1,4-dioxane |
|---|---|
| PubChem CID | 11141751 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2R,3R,5R,6R)-2,3-diphenyl-5,6-bis(prop-2-enyl)-1,4-dioxane |
| SMILES | C=CC[C@H]1O[C@H](c2ccccc2)[C@@H](c2ccccc2)O[C@@H]1CC=C |
| InChI | InChI=1S/C22H24O2/c1-3-11-19-20(12-4-2)24-22(18-15-9-6-10-16-18)21(23-19)17-13-7-5-8-14-17/h3-10,13-16,19-22H,1-2,11-12H2/t19-,20-,21-,22-/m1/s1 |
| InChIKey | IMOHTHOATRVEIR-GXRSIYKFSA-N |
| XLogP | 5.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|