C14H18O3 — CID 154130862
3-(2-ethenyl-5-phenyl-1,3-dioxolan-4-yl)propan-1-ol (PubChem CID 154130862) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 3-(2-ethenyl-5-phenyl-1,3-dioxolan-4-yl)propan-1-ol.
| Compound Name | 3-(2-ethenyl-5-phenyl-1,3-dioxolan-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 154130862 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 3-(2-ethenyl-5-phenyl-1,3-dioxolan-4-yl)propan-1-ol |
| SMILES | C=CC1OC(CCCO)C(c2ccccc2)O1 |
| InChI | InChI=1S/C14H18O3/c1-2-13-16-12(9-6-10-15)14(17-13)11-7-4-3-5-8-11/h2-5,7-8,12-15H,1,6,9-10H2 |
| InChIKey | GLJRDSFTAXWFPU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|