C23H28O3 — CID 134931143
(3R)-3-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]oct-1-en-3-ol (PubChem CID 134931143) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is (3R)-3-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]oct-1-en-3-ol.
| Compound Name | (3R)-3-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]oct-1-en-3-ol |
|---|---|
| PubChem CID | 134931143 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (3R)-3-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]oct-1-en-3-ol |
| SMILES | C=C[C@](O)(CCCCC)C1O[C@H](c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C23H28O3/c1-3-5-12-17-23(24,4-2)22-25-20(18-13-8-6-9-14-18)21(26-22)19-15-10-7-11-16-19/h4,6-11,13-16,20-22,24H,2-3,5,12,17H2,1H3/t20-,21-,23+/m1/s1 |
| InChIKey | ICFWRLQJHGFFMY-XPNTWCBSSA-N |
| XLogP | 5.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|