C22H24O3 — CID 102216647
4-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]hepta-1,6-dien-4-ol (PubChem CID 102216647) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is 4-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]hepta-1,6-dien-4-ol.
| Compound Name | 4-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 102216647 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-[(4R,5R)-4,5-diphenyl-1,3-dioxolan-2-yl]hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(CC=C)C1O[C@H](c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C22H24O3/c1-3-15-22(23,16-4-2)21-24-19(17-11-7-5-8-12-17)20(25-21)18-13-9-6-10-14-18/h3-14,19-21,23H,1-2,15-16H2/t19-,20-/m1/s1 |
| InChIKey | OVJSUYICUJITQS-WOJBJXKFSA-N |
| XLogP | 4.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|