C11H12O2 — CID 10631104
(1S)-1-[(2R,3R)-3-phenyloxiran-2-yl]prop-2-en-1-ol (PubChem CID 10631104) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is (1S)-1-[(2R,3R)-3-phenyloxiran-2-yl]prop-2-en-1-ol.
| Compound Name | (1S)-1-[(2R,3R)-3-phenyloxiran-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 10631104 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1S)-1-[(2R,3R)-3-phenyloxiran-2-yl]prop-2-en-1-ol |
| SMILES | C=C[C@H](O)[C@H]1O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-2-9(12)11-10(13-11)8-6-4-3-5-7-8/h2-7,9-12H,1H2/t9-,10+,11+/m0/s1 |
| InChIKey | FUYNCVSPBVYCDQ-HBNTYKKESA-N |
| XLogP | 1.67 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|