C10H9Cl3O2 — CID 10989251
(1R)-2,2,2-trichloro-1-[(2S,3S)-3-phenyloxiran-2-yl]ethanol (PubChem CID 10989251) has the molecular formula C10H9Cl3O2 and a molecular weight of 267.54 g/mol. Its IUPAC name is (1R)-2,2,2-trichloro-1-[(2S,3S)-3-phenyloxiran-2-yl]ethanol.
| Compound Name | (1R)-2,2,2-trichloro-1-[(2S,3S)-3-phenyloxiran-2-yl]ethanol |
|---|---|
| PubChem CID | 10989251 |
| Molecular Formula | C10H9Cl3O2 |
| Molecular Weight | 267.54 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | (1R)-2,2,2-trichloro-1-[(2S,3S)-3-phenyloxiran-2-yl]ethanol |
| SMILES | O[C@H]([C@@H]1O[C@H]1c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H9Cl3O2/c11-10(12,13)9(14)8-7(15-8)6-4-2-1-3-5-6/h1-5,7-9,14H/t7-,8+,9+/m0/s1 |
| InChIKey | QGMPDCSRLPESFT-DJLDLDEBSA-N |
| XLogP | 2.86 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|