C17H13Cl3O3 — CID 101115504
[(1R)-2,2,2-trichloro-1-[(2S,3S)-3-phenyloxiran-2-yl]ethyl] benzoate (PubChem CID 101115504) has the molecular formula C17H13Cl3O3 and a molecular weight of 371.65 g/mol. Its IUPAC name is [(1R)-2,2,2-trichloro-1-[(2S,3S)-3-phenyloxiran-2-yl]ethyl] benzoate.
| Compound Name | [(1R)-2,2,2-trichloro-1-[(2S,3S)-3-phenyloxiran-2-yl]ethyl] benzoate |
|---|---|
| PubChem CID | 101115504 |
| Molecular Formula | C17H13Cl3O3 |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | [(1R)-2,2,2-trichloro-1-[(2S,3S)-3-phenyloxiran-2-yl]ethyl] benzoate |
| SMILES | O=C(O[C@H]([C@H]1O[C@H]1c1ccccc1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C17H13Cl3O3/c18-17(19,20)15(23-16(21)12-9-5-2-6-10-12)14-13(22-14)11-7-3-1-4-8-11/h1-10,13-15H/t13-,14-,15+/m0/s1 |
| InChIKey | VJLFCCJKNCCTAD-SOUVJXGZSA-N |
| XLogP | 4.72 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|