C33H28O8 — CID 161447624
[(3R,4R,5S,6R)-2,3-dibenzoyloxy-5-methoxy-6-phenyloxan-4-yl] benzoate (PubChem CID 161447624) has the molecular formula C33H28O8 and a molecular weight of 552.58 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-2,3-dibenzoyloxy-5-methoxy-6-phenyloxan-4-yl] benzoate.
| Compound Name | [(3R,4R,5S,6R)-2,3-dibenzoyloxy-5-methoxy-6-phenyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 161447624 |
| Molecular Formula | C33H28O8 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | [(3R,4R,5S,6R)-2,3-dibenzoyloxy-5-methoxy-6-phenyloxan-4-yl] benzoate |
| SMILES | CO[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C33H28O8/c1-37-27-26(22-14-6-2-7-15-22)40-33(41-32(36)25-20-12-5-13-21-25)29(39-31(35)24-18-10-4-11-19-24)28(27)38-30(34)23-16-8-3-9-17-23/h2-21,26-29,33H,1H3/t26-,27+,28-,29-,33?/m1/s1 |
| InChIKey | YYRPXTSPFKEBGD-XUZKQBHQSA-N |
| XLogP | 5.41 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|