C25H19BrO7 — CID 135046318
[(2R,3S,4R)-2,4-dibenzoyloxy-5-bromooxolan-3-yl] benzoate (PubChem CID 135046318) has the molecular formula C25H19BrO7 and a molecular weight of 511.32 g/mol. Its IUPAC name is [(2R,3S,4R)-2,4-dibenzoyloxy-5-bromooxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R)-2,4-dibenzoyloxy-5-bromooxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 135046318 |
| Molecular Formula | C25H19BrO7 |
| Molecular Weight | 511.32 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | [(2R,3S,4R)-2,4-dibenzoyloxy-5-bromooxolan-3-yl] benzoate |
| SMILES | O=C(O[C@@H]1OC(Br)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H19BrO7/c26-21-19(30-22(27)16-10-4-1-5-11-16)20(31-23(28)17-12-6-2-7-13-17)25(32-21)33-24(29)18-14-8-3-9-15-18/h1-15,19-21,25H/t19-,20+,21?,25+/m1/s1 |
| InChIKey | ZXADWHGOPLCZHF-OEPOVDHGSA-N |
| XLogP | 4.37 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|