C15H22O4 — CID 139803227
6-(3-phenyloxiran-2-yl)heptane-2,2,5-triol (PubChem CID 139803227) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 6-(3-phenyloxiran-2-yl)heptane-2,2,5-triol.
| Compound Name | 6-(3-phenyloxiran-2-yl)heptane-2,2,5-triol |
|---|---|
| PubChem CID | 139803227 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 6-(3-phenyloxiran-2-yl)heptane-2,2,5-triol |
| SMILES | CC(C(O)CCC(C)(O)O)C1OC1c1ccccc1 |
| InChI | InChI=1S/C15H22O4/c1-10(12(16)8-9-15(2,17)18)13-14(19-13)11-6-4-3-5-7-11/h3-7,10,12-14,16-18H,8-9H2,1-2H3 |
| InChIKey | RDIFHMAUHQVGAN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|