C14H18O2 — CID 135446200
(2S,3S)-2-[(2R,3S)-3-phenyloxiran-2-yl]hex-5-en-3-ol (PubChem CID 135446200) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (2S,3S)-2-[(2R,3S)-3-phenyloxiran-2-yl]hex-5-en-3-ol.
| Compound Name | (2S,3S)-2-[(2R,3S)-3-phenyloxiran-2-yl]hex-5-en-3-ol |
|---|---|
| PubChem CID | 135446200 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (2S,3S)-2-[(2R,3S)-3-phenyloxiran-2-yl]hex-5-en-3-ol |
| SMILES | C=CC[C@H](O)[C@H](C)[C@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H18O2/c1-3-7-12(15)10(2)13-14(16-13)11-8-5-4-6-9-11/h3-6,8-10,12-15H,1,7H2,2H3/t10-,12-,13+,14-/m0/s1 |
| InChIKey | BAVUDCWWXIHGGO-DEQVHRJGSA-N |
| XLogP | 2.70 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|