C17H13ClO4 — CID 135958935
5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one (PubChem CID 135958935) has the molecular formula C17H13ClO4 and a molecular weight of 316.74 g/mol. Its IUPAC name is 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one.
| Compound Name | 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 135958935 |
| Molecular Formula | C17H13ClO4 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one |
| SMILES | O=C1c2cc(Cl)ccc2OC1C(O)[C@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H13ClO4/c18-10-6-7-12-11(8-10)13(19)16(21-12)14(20)17-15(22-17)9-4-2-1-3-5-9/h1-8,14-17,20H/t14?,15-,16?,17+/m0/s1 |
| InChIKey | DMXWKPQPZAWADM-ODZFXCKXSA-N |
| XLogP | 2.78 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|