About 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one
5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one (PubChem CID 135958935) has the molecular formula C17H13ClO4
and a molecular weight of 316.74 g/mol. Its IUPAC name is 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one.
Molecular Properties
| Compound Name | 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one |
| PubChem CID | 135958935 |
| Molecular Formula | C17H13ClO4 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one |
| SMILES | O=C1c2cc(Cl)ccc2OC1C(O)[C@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H13ClO4/c18-10-6-7-12-11(8-10)13(19)16(21-12)14(20)17-15(22-17)9-4-2-1-3-5-9/h1-8,14-17,20H/t14?,15-,16?,17+/m0/s1 |
| InChIKey | DMXWKPQPZAWADM-ODZFXCKXSA-N |
| XLogP | 2.78 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one?
The IUPAC name of 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one (CID 135958935) is 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one.
What is the SMILES notation for 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one?
The canonical SMILES for 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one is O=C1c2cc(Cl)ccc2OC1C(O)[C@H]1O[C@H]1c1ccccc1.
What is the InChIKey of 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one?
The InChIKey is DMXWKPQPZAWADM-ODZFXCKXSA-N. The full InChI is InChI=1S/C17H13ClO4/c18-10-6-7-12-11(8-10)13(19)16(21-12)14(20)17-15(22-17)9-4-2-1-3-5-9/h1-8,14-17,20H/t14?,15-,16?,17+/m0/s1.
What are the key properties of 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one?
5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one has a molecular weight of 316.74 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[hydroxy-[(2R,3S)-3-phenyloxiran-2-yl]methyl]-1-benzofuran-3-one is sourced from PubChem (CID 135958935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).