C10H11ClO2 — CID 132937968
(1R)-1-[(2S,3S)-3-(3-chlorophenyl)oxiran-2-yl]ethanol (PubChem CID 132937968) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is (1R)-1-[(2S,3S)-3-(3-chlorophenyl)oxiran-2-yl]ethanol.
| Compound Name | (1R)-1-[(2S,3S)-3-(3-chlorophenyl)oxiran-2-yl]ethanol |
|---|---|
| PubChem CID | 132937968 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | (1R)-1-[(2S,3S)-3-(3-chlorophenyl)oxiran-2-yl]ethanol |
| SMILES | C[C@@H](O)[C@@H]1O[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H11ClO2/c1-6(12)9-10(13-9)7-3-2-4-8(11)5-7/h2-6,9-10,12H,1H3/t6-,9+,10+/m1/s1 |
| InChIKey | GSICLTCWJYKTJR-UASFKTIASA-N |
| XLogP | 2.16 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|