C9H11NO — CID 10964671
[(2R,3S)-3-phenyloxiran-2-yl]methanamine (PubChem CID 10964671) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is [(2R,3S)-3-phenyloxiran-2-yl]methanamine.
| Compound Name | [(2R,3S)-3-phenyloxiran-2-yl]methanamine |
|---|---|
| PubChem CID | 10964671 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | [(2R,3S)-3-phenyloxiran-2-yl]methanamine |
| SMILES | NC[C@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C9H11NO/c10-6-8-9(11-8)7-4-2-1-3-5-7/h1-5,8-9H,6,10H2/t8-,9+/m1/s1 |
| InChIKey | HHGZCFDVFNFNLX-BDAKNGLRSA-N |
| XLogP | 1.09 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|