C10H10O3 — CID 135891060
2-[(2R,3S)-3-phenyloxiran-2-yl]acetic acid (PubChem CID 135891060) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-[(2R,3S)-3-phenyloxiran-2-yl]acetic acid.
| Compound Name | 2-[(2R,3S)-3-phenyloxiran-2-yl]acetic acid |
|---|---|
| PubChem CID | 135891060 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-[(2R,3S)-3-phenyloxiran-2-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C10H10O3/c11-9(12)6-8-10(13-8)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-,10+/m1/s1 |
| InChIKey | YSOFBKFZDRIOPQ-SCZZXKLOSA-N |
| XLogP | 1.60 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|