C19H17NO5 — CID 134563097
2-[(1S,4R,5R,7S)-2-oxo-3,4-diphenyl-6,8-dioxa-3-azabicyclo[3.2.1]octan-7-yl]acetic acid (PubChem CID 134563097) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[(1S,4R,5R,7S)-2-oxo-3,4-diphenyl-6,8-dioxa-3-azabicyclo[3.2.1]octan-7-yl]acetic acid.
| Compound Name | 2-[(1S,4R,5R,7S)-2-oxo-3,4-diphenyl-6,8-dioxa-3-azabicyclo[3.2.1]octan-7-yl]acetic acid |
|---|---|
| PubChem CID | 134563097 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[(1S,4R,5R,7S)-2-oxo-3,4-diphenyl-6,8-dioxa-3-azabicyclo[3.2.1]octan-7-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1O[C@@H]2O[C@@H]1C(=O)N(c1ccccc1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C19H17NO5/c21-15(22)11-14-17-18(23)20(13-9-5-2-6-10-13)16(19(24-14)25-17)12-7-3-1-4-8-12/h1-10,14,16-17,19H,11H2,(H,21,22)/t14-,16+,17-,19+/m0/s1 |
| InChIKey | RXAKYHHOSXATIB-LKCYJCQHSA-N |
| XLogP | 2.36 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |