C12H13IO3 — CID 15441068
2-[(2R,4S,5R)-4-iodo-5-phenyloxolan-2-yl]acetic acid (PubChem CID 15441068) has the molecular formula C12H13IO3 and a molecular weight of 332.14 g/mol. Its IUPAC name is 2-[(2R,4S,5R)-4-iodo-5-phenyloxolan-2-yl]acetic acid.
| Compound Name | 2-[(2R,4S,5R)-4-iodo-5-phenyloxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 15441068 |
| Molecular Formula | C12H13IO3 |
| Molecular Weight | 332.14 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 2-[(2R,4S,5R)-4-iodo-5-phenyloxolan-2-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1C[C@H](I)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C12H13IO3/c13-10-6-9(7-11(14)15)16-12(10)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,14,15)/t9-,10-,12+/m0/s1 |
| InChIKey | XQQPXQSTTXHXRH-JBLDHEPKSA-N |
| XLogP | 2.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|