C14H15NO2 — CID 10443802
(3aR,4R,6R)-6-phenyl-4-prop-2-enyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole (PubChem CID 10443802) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is (3aR,4R,6R)-6-phenyl-4-prop-2-enyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole.
| Compound Name | (3aR,4R,6R)-6-phenyl-4-prop-2-enyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 10443802 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (3aR,4R,6R)-6-phenyl-4-prop-2-enyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole |
| SMILES | C=CC[C@H]1O[C@H](c2ccccc2)C2=NOC[C@@H]21 |
| InChI | InChI=1S/C14H15NO2/c1-2-6-12-11-9-16-15-13(11)14(17-12)10-7-4-3-5-8-10/h2-5,7-8,11-12,14H,1,6,9H2/t11-,12-,14-/m1/s1 |
| InChIKey | HEKCCARZUXWNTP-YRGRVCCFSA-N |
| XLogP | 2.70 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|