C17H15NO2 — CID 10333086
(3aR,4S,6S)-4,6-diphenyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole (PubChem CID 10333086) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is (3aR,4S,6S)-4,6-diphenyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole.
| Compound Name | (3aR,4S,6S)-4,6-diphenyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 10333086 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (3aR,4S,6S)-4,6-diphenyl-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazole |
| SMILES | c1ccc([C@@H]2O[C@H](c3ccccc3)[C@H]3CON=C23)cc1 |
| InChI | InChI=1S/C17H15NO2/c1-3-7-12(8-4-1)16-14-11-19-18-15(14)17(20-16)13-9-5-2-6-10-13/h1-10,14,16-17H,11H2/t14-,16+,17-/m0/s1 |
| InChIKey | ZZPZCHKAXXMJHJ-UAGQMJEPSA-N |
| XLogP | 3.50 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |