C9H9NO — CID 140967269
(4R)-4-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 140967269) has the molecular formula C9H9NO and a molecular weight of 147.18 g/mol. Its IUPAC name is (4R)-4-phenyl-4,5-dihydro-1,2-oxazole.
| Compound Name | (4R)-4-phenyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 140967269 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (4R)-4-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | C1=NOC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C9H9NO/c1-2-4-8(5-3-1)9-6-10-11-7-9/h1-6,9H,7H2/t9-/m1/s1 |
| InChIKey | YTLBJGQHFLJKIX-SECBINFHSA-N |
| XLogP | 1.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |