C9H9FN2 — CID 174948673
2-fluoro-4-phenyl-3,4-dihydropyrazole (PubChem CID 174948673) has the molecular formula C9H9FN2 and a molecular weight of 164.18 g/mol. Its IUPAC name is 2-fluoro-4-phenyl-3,4-dihydropyrazole.
| Compound Name | 2-fluoro-4-phenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 174948673 |
| Molecular Formula | C9H9FN2 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-fluoro-4-phenyl-3,4-dihydropyrazole |
| SMILES | FN1CC(c2ccccc2)C=N1 |
| InChI | InChI=1S/C9H9FN2/c10-12-7-9(6-11-12)8-4-2-1-3-5-8/h1-6,9H,7H2 |
| InChIKey | HPUXSKSAUJTMEQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|