About 2-fluoro-4-phenyl-3,4-dihydropyrazole
2-fluoro-4-phenyl-3,4-dihydropyrazole (PubChem CID 174948673) has the molecular formula C9H9FN2
and a molecular weight of 164.18 g/mol. Its IUPAC name is 2-fluoro-4-phenyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2-fluoro-4-phenyl-3,4-dihydropyrazole |
| PubChem CID | 174948673 |
| Molecular Formula | C9H9FN2 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-fluoro-4-phenyl-3,4-dihydropyrazole |
| SMILES | FN1CC(c2ccccc2)C=N1 |
| InChI | InChI=1S/C9H9FN2/c10-12-7-9(6-11-12)8-4-2-1-3-5-8/h1-6,9H,7H2 |
| InChIKey | HPUXSKSAUJTMEQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-phenyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-phenyl-3,4-dihydropyrazole?
The IUPAC name of 2-fluoro-4-phenyl-3,4-dihydropyrazole (CID 174948673) is 2-fluoro-4-phenyl-3,4-dihydropyrazole.
What is the SMILES notation for 2-fluoro-4-phenyl-3,4-dihydropyrazole?
The canonical SMILES for 2-fluoro-4-phenyl-3,4-dihydropyrazole is FN1CC(c2ccccc2)C=N1.
What is the InChIKey of 2-fluoro-4-phenyl-3,4-dihydropyrazole?
The InChIKey is HPUXSKSAUJTMEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2/c10-12-7-9(6-11-12)8-4-2-1-3-5-8/h1-6,9H,7H2.
What are the key properties of 2-fluoro-4-phenyl-3,4-dihydropyrazole?
2-fluoro-4-phenyl-3,4-dihydropyrazole has a molecular weight of 164.18 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-phenyl-3,4-dihydropyrazole is sourced from PubChem (CID 174948673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).