C17H16S — CID 101401487
(2R,4R)-2,4-diphenyl-3,4-dihydro-2H-thiopyran (PubChem CID 101401487) has the molecular formula C17H16S and a molecular weight of 252.38 g/mol. Its IUPAC name is (2R,4R)-2,4-diphenyl-3,4-dihydro-2H-thiopyran.
| Compound Name | (2R,4R)-2,4-diphenyl-3,4-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 101401487 |
| Molecular Formula | C17H16S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (2R,4R)-2,4-diphenyl-3,4-dihydro-2H-thiopyran |
| SMILES | C1=C[C@H](c2ccccc2)C[C@H](c2ccccc2)S1 |
| InChI | InChI=1S/C17H16S/c1-3-7-14(8-4-1)16-11-12-18-17(13-16)15-9-5-2-6-10-15/h1-12,16-17H,13H2/t16-,17+/m0/s1 |
| InChIKey | FOTXIRXJGALNIY-DLBZAZTESA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |