C17H18S — CID 7065629
(2S,6S)-2,6-diphenylthiane (PubChem CID 7065629) has the molecular formula C17H18S and a molecular weight of 254.40 g/mol. Its IUPAC name is (2S,6S)-2,6-diphenylthiane.
| Compound Name | (2S,6S)-2,6-diphenylthiane |
|---|---|
| PubChem CID | 7065629 |
| Molecular Formula | C17H18S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2S,6S)-2,6-diphenylthiane |
| SMILES | c1ccc([C@@H]2CCC[C@@H](c3ccccc3)S2)cc1 |
| InChI | InChI=1S/C17H18S/c1-3-8-14(9-4-1)16-12-7-13-17(18-16)15-10-5-2-6-11-15/h1-6,8-11,16-17H,7,12-13H2/t16-,17-/m0/s1 |
| InChIKey | WGVHOPHBSLEVFP-IRXDYDNUSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |