C15H20S — CID 11864427
(2S,4aR,8aS)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromene (PubChem CID 11864427) has the molecular formula C15H20S and a molecular weight of 232.39 g/mol. Its IUPAC name is (2S,4aR,8aS)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromene.
| Compound Name | (2S,4aR,8aS)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromene |
|---|---|
| PubChem CID | 11864427 |
| Molecular Formula | C15H20S |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2S,4aR,8aS)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromene |
| SMILES | c1ccc([C@@H]2CC[C@H]3CCCC[C@@H]3S2)cc1 |
| InChI | InChI=1S/C15H20S/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15/h1-3,6-7,13-15H,4-5,8-11H2/t13-,14+,15+/m1/s1 |
| InChIKey | XUHFBJQAGLCUGE-ILXRZTDVSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |