C14H18S — CID 7115008
(1S,3aR,7aS)-1-phenyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene (PubChem CID 7115008) has the molecular formula C14H18S and a molecular weight of 218.37 g/mol. Its IUPAC name is (1S,3aR,7aS)-1-phenyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene.
| Compound Name | (1S,3aR,7aS)-1-phenyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
|---|---|
| PubChem CID | 7115008 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (1S,3aR,7aS)-1-phenyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
| SMILES | c1ccc([C@H]2SC[C@@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C14H18S/c1-2-6-11(7-3-1)14-13-9-5-4-8-12(13)10-15-14/h1-3,6-7,12-14H,4-5,8-10H2/t12-,13-,14+/m0/s1 |
| InChIKey | RVQGXWUCKKXRJV-MELADBBJSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |