C14H18OS — CID 15689057
(6aR,10aS,11S)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzothiepin-11-ol (PubChem CID 15689057) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is (6aR,10aS,11S)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzothiepin-11-ol.
| Compound Name | (6aR,10aS,11S)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzothiepin-11-ol |
|---|---|
| PubChem CID | 15689057 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (6aR,10aS,11S)-6,6a,7,8,9,10,10a,11-octahydrobenzo[c][1]benzothiepin-11-ol |
| SMILES | O[C@@H]1c2ccccc2SC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C14H18OS/c15-14-11-6-2-1-5-10(11)9-16-13-8-4-3-7-12(13)14/h3-4,7-8,10-11,14-15H,1-2,5-6,9H2/t10-,11-,14-/m0/s1 |
| InChIKey | DIQIOLXEBBPJIL-MJVIPROJSA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |