C17H22S — CID 158511904
2,3,4,4a,4b,5,10b,11,12,12a-decahydro-1H-naphtho[1,2-c]thiochromene (PubChem CID 158511904) has the molecular formula C17H22S and a molecular weight of 258.43 g/mol. Its IUPAC name is 2,3,4,4a,4b,5,10b,11,12,12a-decahydro-1H-naphtho[1,2-c]thiochromene.
| Compound Name | 2,3,4,4a,4b,5,10b,11,12,12a-decahydro-1H-naphtho[1,2-c]thiochromene |
|---|---|
| PubChem CID | 158511904 |
| Molecular Formula | C17H22S |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2,3,4,4a,4b,5,10b,11,12,12a-decahydro-1H-naphtho[1,2-c]thiochromene |
| SMILES | c1ccc2c(c1)SCC1C2CCC2CCCCC21 |
| InChI | InChI=1S/C17H22S/c1-2-6-13-12(5-1)9-10-14-15-7-3-4-8-17(15)18-11-16(13)14/h3-4,7-8,12-14,16H,1-2,5-6,9-11H2 |
| InChIKey | HLDWOQVZQYNMOL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |