C12H15NS — CID 178102394
3-(2,3-dihydro-1-benzothiophen-3-yl)pyrrolidine (PubChem CID 178102394) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzothiophen-3-yl)pyrrolidine.
| Compound Name | 3-(2,3-dihydro-1-benzothiophen-3-yl)pyrrolidine |
|---|---|
| PubChem CID | 178102394 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-(2,3-dihydro-1-benzothiophen-3-yl)pyrrolidine |
| SMILES | c1ccc2c(c1)SCC2C1CCNC1 |
| InChI | InChI=1S/C12H15NS/c1-2-4-12-10(3-1)11(8-14-12)9-5-6-13-7-9/h1-4,9,11,13H,5-8H2 |
| InChIKey | GJJHFXXIHRWAJU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |