C14H17N — CID 19043208
3-(1,2-dihydronaphthalen-1-yl)pyrrolidine (PubChem CID 19043208) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 3-(1,2-dihydronaphthalen-1-yl)pyrrolidine.
| Compound Name | 3-(1,2-dihydronaphthalen-1-yl)pyrrolidine |
|---|---|
| PubChem CID | 19043208 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3-(1,2-dihydronaphthalen-1-yl)pyrrolidine |
| SMILES | C1=Cc2ccccc2C(C2CCNC2)C1 |
| InChI | InChI=1S/C14H17N/c1-2-6-13-11(4-1)5-3-7-14(13)12-8-9-15-10-12/h1-6,12,14-15H,7-10H2 |
| InChIKey | YROQNIFOSYXJPV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |