C10H11P — CID 154530712
1,2-dihydronaphthalen-1-ylphosphane (PubChem CID 154530712) has the molecular formula C10H11P and a molecular weight of 162.17 g/mol. Its IUPAC name is 1,2-dihydronaphthalen-1-ylphosphane.
| Compound Name | 1,2-dihydronaphthalen-1-ylphosphane |
|---|---|
| PubChem CID | 154530712 |
| Molecular Formula | C10H11P |
| Molecular Weight | 162.17 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 1,2-dihydronaphthalen-1-ylphosphane |
| SMILES | PC1CC=Cc2ccccc21 |
| InChI | InChI=1S/C10H11P/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-6,10H,7,11H2 |
| InChIKey | MFEPWYPETIDQBG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.17 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|