About 7-cyclopentyl-1H-indene
7-cyclopentyl-1H-indene (PubChem CID 141045595) has the molecular formula C14H16
and a molecular weight of 184.28 g/mol. Its IUPAC name is 7-cyclopentyl-1H-indene.
Molecular Properties
| Compound Name | 7-cyclopentyl-1H-indene |
| PubChem CID | 141045595 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 7-cyclopentyl-1H-indene |
| SMILES | C1=Cc2cccc(C3CCCC3)c2C1 |
| InChI | InChI=1S/C14H16/c1-2-6-11(5-1)13-9-3-7-12-8-4-10-14(12)13/h3-4,7-9,11H,1-2,5-6,10H2 |
| InChIKey | BSRYRODEIVXRFW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-cyclopentyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopentyl-1H-indene?
The IUPAC name of 7-cyclopentyl-1H-indene (CID 141045595) is 7-cyclopentyl-1H-indene.
What is the SMILES notation for 7-cyclopentyl-1H-indene?
The canonical SMILES for 7-cyclopentyl-1H-indene is C1=Cc2cccc(C3CCCC3)c2C1.
What is the InChIKey of 7-cyclopentyl-1H-indene?
The InChIKey is BSRYRODEIVXRFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16/c1-2-6-11(5-1)13-9-3-7-12-8-4-10-14(12)13/h3-4,7-9,11H,1-2,5-6,10H2.
What are the key properties of 7-cyclopentyl-1H-indene?
7-cyclopentyl-1H-indene has a molecular weight of 184.28 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopentyl-1H-indene is sourced from PubChem (CID 141045595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).