C21H28 — CID 173356994
4,5-dicyclohexyl-1H-indene (PubChem CID 173356994) has the molecular formula C21H28 and a molecular weight of 280.45 g/mol. Its IUPAC name is 4,5-dicyclohexyl-1H-indene.
| Compound Name | 4,5-dicyclohexyl-1H-indene |
|---|---|
| PubChem CID | 173356994 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 4,5-dicyclohexyl-1H-indene |
| SMILES | C1=Cc2c(ccc(C3CCCCC3)c2C2CCCCC2)C1 |
| InChI | InChI=1S/C21H28/c1-3-8-16(9-4-1)20-15-14-17-12-7-13-19(17)21(20)18-10-5-2-6-11-18/h7,13-16,18H,1-6,8-12H2 |
| InChIKey | JRGNCQNVCSVXKH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |