C16H15ClO2 — CID 142060832
4-chlorophenol;1,2-dihydronaphthalen-1-ol (PubChem CID 142060832) has the molecular formula C16H15ClO2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 4-chlorophenol;1,2-dihydronaphthalen-1-ol.
| Compound Name | 4-chlorophenol;1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 142060832 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-chlorophenol;1,2-dihydronaphthalen-1-ol |
| SMILES | OC1CC=Cc2ccccc21.Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H10O.C6H5ClO/c11-10-7-3-5-8-4-1-2-6-9(8)10;7-5-1-3-6(8)4-2-5/h1-6,10-11H,7H2;1-4,8H |
| InChIKey | LHYICOZPHPLNBP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |