About 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol
6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol (PubChem CID 139678964) has the molecular formula C14H12OS
and a molecular weight of 228.32 g/mol. Its IUPAC name is 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol |
| PubChem CID | 139678964 |
| Molecular Formula | C14H12OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol |
| SMILES | OC1CC=Cc2cc(-c3cccs3)ccc21 |
| InChI | InChI=1S/C14H12OS/c15-13-4-1-3-10-9-11(6-7-12(10)13)14-5-2-8-16-14/h1-3,5-9,13,15H,4H2 |
| InChIKey | BNWMICCAQMRYCF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol?
The IUPAC name of 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol (CID 139678964) is 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol.
What is the SMILES notation for 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol?
The canonical SMILES for 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol is OC1CC=Cc2cc(-c3cccs3)ccc21.
What is the InChIKey of 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol?
The InChIKey is BNWMICCAQMRYCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12OS/c15-13-4-1-3-10-9-11(6-7-12(10)13)14-5-2-8-16-14/h1-3,5-9,13,15H,4H2.
What are the key properties of 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol?
6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol has a molecular weight of 228.32 g/mol, XLogP of 3.87, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol is sourced from PubChem (CID 139678964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).