C14H12OS — CID 139678964
6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol (PubChem CID 139678964) has the molecular formula C14H12OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol.
| Compound Name | 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 139678964 |
| Molecular Formula | C14H12OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 6-thiophen-2-yl-1,2-dihydronaphthalen-1-ol |
| SMILES | OC1CC=Cc2cc(-c3cccs3)ccc21 |
| InChI | InChI=1S/C14H12OS/c15-13-4-1-3-10-9-11(6-7-12(10)13)14-5-2-8-16-14/h1-3,5-9,13,15H,4H2 |
| InChIKey | BNWMICCAQMRYCF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |