C17H18O2 — CID 142060836
(1R)-1,2-dihydronaphthalen-1-ol;4-methylphenol (PubChem CID 142060836) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1R)-1,2-dihydronaphthalen-1-ol;4-methylphenol.
| Compound Name | (1R)-1,2-dihydronaphthalen-1-ol;4-methylphenol |
|---|---|
| PubChem CID | 142060836 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (1R)-1,2-dihydronaphthalen-1-ol;4-methylphenol |
| SMILES | Cc1ccc(O)cc1.O[C@@H]1CC=Cc2ccccc21 |
| InChI | InChI=1S/C10H10O.C7H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-6-2-4-7(8)5-3-6/h1-6,10-11H,7H2;2-5,8H,1H3/t10-;/m1./s1 |
| InChIKey | HLGFBFFGPRMJSK-HNCPQSOCSA-N |
| XLogP | 3.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |