C11H9N4S — CID 167996619
5H-Tetrazole-5-thione,1,2-dihydro-1-(1-naphthalenyl)- (PubChem CID 167996619) has the molecular formula C11H9N4S and a molecular weight of 229.29 g/mol.
| Compound Name | 5H-Tetrazole-5-thione,1,2-dihydro-1-(1-naphthalenyl)- |
|---|---|
| PubChem CID | 167996619 |
| Molecular Formula | C11H9N4S |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | — |
| SMILES | C1=Cc2ccccc2C([S]=C2N=NN=N2)C1 |
| InChI | InChI=1S/C11H9N4S/c1-2-6-9-8(4-1)5-3-7-10(9)16-11-12-14-15-13-11/h1-6,10H,7H2 |
| InChIKey | WSPOBYWDELWRFR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|