C11H12O — CID 11252162
(1R,2R)-2-methyl-1,2-dihydronaphthalen-1-ol (PubChem CID 11252162) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (1R,2R)-2-methyl-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1R,2R)-2-methyl-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 11252162 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (1R,2R)-2-methyl-1,2-dihydronaphthalen-1-ol |
| SMILES | C[C@@H]1C=Cc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C11H12O/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-8,11-12H,1H3/t8-,11-/m1/s1 |
| InChIKey | PVRGMTGDVJIXGL-LDYMZIIASA-N |
| XLogP | 2.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |