C12H12O — CID 10749718
(1S,2R)-2-methyl-1,2-dihydronaphthalene-1-carbaldehyde (PubChem CID 10749718) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is (1S,2R)-2-methyl-1,2-dihydronaphthalene-1-carbaldehyde.
| Compound Name | (1S,2R)-2-methyl-1,2-dihydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 10749718 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (1S,2R)-2-methyl-1,2-dihydronaphthalene-1-carbaldehyde |
| SMILES | C[C@@H]1C=Cc2ccccc2[C@H]1C=O |
| InChI | InChI=1S/C12H12O/c1-9-6-7-10-4-2-3-5-11(10)12(9)8-13/h2-9,12H,1H3/t9-,12+/m1/s1 |
| InChIKey | SEVJZOMKOOIBKI-SKDRFNHKSA-N |
| XLogP | 2.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|