C23H24O2 — CID 157187366
11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene;(1S,2R)-2-propan-2-yl-1,2-dihydronaphthalen-1-ol (PubChem CID 157187366) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is 11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene;(1S,2R)-2-propan-2-yl-1,2-dihydronaphthalen-1-ol.
| Compound Name | 11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene;(1S,2R)-2-propan-2-yl-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 157187366 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene;(1S,2R)-2-propan-2-yl-1,2-dihydronaphthalen-1-ol |
| SMILES | C1=CC2OC1c1ccccc12.CC(C)[C@@H]1C=Cc2ccccc2[C@H]1O |
| InChI | InChI=1S/C13H16O.C10H8O/c1-9(2)11-8-7-10-5-3-4-6-12(10)13(11)14;1-2-4-8-7(3-1)9-5-6-10(8)11-9/h3-9,11,13-14H,1-2H3;1-6,9-10H/t11-,13-;/m0./s1 |
| InChIKey | APGXDJOUQFBLHB-JZKFLRDJSA-N |
| XLogP | 5.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|