C14H18O — CID 10726808
[(1R,2S)-2-propan-2-yl-1,2-dihydronaphthalen-1-yl]methanol (PubChem CID 10726808) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is [(1R,2S)-2-propan-2-yl-1,2-dihydronaphthalen-1-yl]methanol.
| Compound Name | [(1R,2S)-2-propan-2-yl-1,2-dihydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 10726808 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | [(1R,2S)-2-propan-2-yl-1,2-dihydronaphthalen-1-yl]methanol |
| SMILES | CC(C)[C@H]1C=Cc2ccccc2[C@@H]1CO |
| InChI | InChI=1S/C14H18O/c1-10(2)12-8-7-11-5-3-4-6-13(11)14(12)9-15/h3-8,10,12,14-15H,9H2,1-2H3/t12-,14-/m1/s1 |
| InChIKey | HFWMMTSVRDAZTE-TZMCWYRMSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |