C16H20O — CID 135042967
(1R,2R)-2-[(E)-3,3-dimethylbut-1-enyl]-1,2-dihydronaphthalen-1-ol (PubChem CID 135042967) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is (1R,2R)-2-[(E)-3,3-dimethylbut-1-enyl]-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1R,2R)-2-[(E)-3,3-dimethylbut-1-enyl]-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 135042967 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (1R,2R)-2-[(E)-3,3-dimethylbut-1-enyl]-1,2-dihydronaphthalen-1-ol |
| SMILES | CC(C)(C)/C=C/[C@@H]1C=Cc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C16H20O/c1-16(2,3)11-10-13-9-8-12-6-4-5-7-14(12)15(13)17/h4-11,13,15,17H,1-3H3/b11-10+/t13-,15+/m0/s1 |
| InChIKey | DFWWPLPPWJXAGR-VLMQMFMZSA-N |
| XLogP | 3.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|