C13H14O2 — CID 11195024
(1R,2R)-2-prop-2-enoxy-1,2-dihydronaphthalen-1-ol (PubChem CID 11195024) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1R,2R)-2-prop-2-enoxy-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1R,2R)-2-prop-2-enoxy-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 11195024 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (1R,2R)-2-prop-2-enoxy-1,2-dihydronaphthalen-1-ol |
| SMILES | C=CCO[C@@H]1C=Cc2ccccc2[C@H]1O |
| InChI | InChI=1S/C13H14O2/c1-2-9-15-12-8-7-10-5-3-4-6-11(10)13(12)14/h2-8,12-14H,1,9H2/t12-,13-/m1/s1 |
| InChIKey | SOGZTKBFLLLEAU-CHWSQXEVSA-N |
| XLogP | 2.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|