C15H17N — CID 141284861
(1R)-N,N-bis(prop-2-enyl)-1H-inden-1-amine (PubChem CID 141284861) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is (1R)-N,N-bis(prop-2-enyl)-1H-inden-1-amine.
| Compound Name | (1R)-N,N-bis(prop-2-enyl)-1H-inden-1-amine |
|---|---|
| PubChem CID | 141284861 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (1R)-N,N-bis(prop-2-enyl)-1H-inden-1-amine |
| SMILES | C=CCN(CC=C)[C@@H]1C=Cc2ccccc21 |
| InChI | InChI=1S/C15H17N/c1-3-11-16(12-4-2)15-10-9-13-7-5-6-8-14(13)15/h3-10,15H,1-2,11-12H2/t15-/m1/s1 |
| InChIKey | KFJYYXLMEDDMNJ-OAHLLOKOSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|