About 1-ethenyl-1H-indene;titanium(2+);dichloride
1-ethenyl-1H-indene;titanium(2+);dichloride (PubChem CID 86754272) has the molecular formula C11H10Cl2Ti
and a molecular weight of 260.97 g/mol. Its IUPAC name is 1-ethenyl-1H-indene;titanium(2+);dichloride.
Molecular Properties
| Compound Name | 1-ethenyl-1H-indene;titanium(2+);dichloride |
| PubChem CID | 86754272 |
| Molecular Formula | C11H10Cl2Ti |
| Molecular Weight | 260.97 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 1-ethenyl-1H-indene;titanium(2+);dichloride |
| SMILES | C=CC1C=Cc2ccccc21.[Cl-].[Cl-].[Ti+2] |
| InChI | InChI=1S/C11H10.2ClH.Ti/c1-2-9-7-8-10-5-3-4-6-11(9)10;;;/h2-9H,1H2;2*1H;/q;;;+2/p-2 |
| InChIKey | ZMMXRQJAVXKPEB-UHFFFAOYSA-L |
| XLogP | -3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.97 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-1H-indene;titanium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-1H-indene;titanium(2+);dichloride?
The IUPAC name of 1-ethenyl-1H-indene;titanium(2+);dichloride (CID 86754272) is 1-ethenyl-1H-indene;titanium(2+);dichloride.
What is the SMILES notation for 1-ethenyl-1H-indene;titanium(2+);dichloride?
The canonical SMILES for 1-ethenyl-1H-indene;titanium(2+);dichloride is C=CC1C=Cc2ccccc21.[Cl-].[Cl-].[Ti+2].
What is the InChIKey of 1-ethenyl-1H-indene;titanium(2+);dichloride?
The InChIKey is ZMMXRQJAVXKPEB-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H10.2ClH.Ti/c1-2-9-7-8-10-5-3-4-6-11(9)10;;;/h2-9H,1H2;2*1H;/q;;;+2/p-2.
What are the key properties of 1-ethenyl-1H-indene;titanium(2+);dichloride?
1-ethenyl-1H-indene;titanium(2+);dichloride has a molecular weight of 260.97 g/mol, XLogP of -3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-1H-indene;titanium(2+);dichloride is sourced from PubChem (CID 86754272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).