C10H9Cl — CID 175703801
1-chloro-1,2-dideuterio-2H-naphthalene (PubChem CID 175703801) has the molecular formula C10H9Cl and a molecular weight of 166.65 g/mol. Its IUPAC name is 1-chloro-1,2-dideuterio-2H-naphthalene.
| Compound Name | 1-chloro-1,2-dideuterio-2H-naphthalene |
|---|---|
| PubChem CID | 175703801 |
| Molecular Formula | C10H9Cl |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 1-chloro-1,2-dideuterio-2H-naphthalene |
| SMILES | [2H]C1C=Cc2ccccc2C1([2H])Cl |
| InChI | InChI=1S/C10H9Cl/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-6,10H,7H2/i7D,10D |
| InChIKey | CPZKPMJXMRKXNU-ZMBDJWRHSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|