C21H11Cl5 — CID 10983050
2-(2,3,4,5,6-pentachlorophenyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene (PubChem CID 10983050) has the molecular formula C21H11Cl5 and a molecular weight of 440.58 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentachlorophenyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene.
| Compound Name | 2-(2,3,4,5,6-pentachlorophenyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 10983050 |
| Molecular Formula | C21H11Cl5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 437.93 |
| IUPAC Name | 2-(2,3,4,5,6-pentachlorophenyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene |
| SMILES | Clc1c(Cl)c(Cl)c(C2c3ccccc3C=Cc3ccccc32)c(Cl)c1Cl |
| InChI | InChI=1S/C21H11Cl5/c22-17-16(18(23)20(25)21(26)19(17)24)15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-10,15H |
| InChIKey | PTBIWARULLAHEG-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|