About N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide
N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 79211900) has the molecular formula C15H20N2OS
and a molecular weight of 276.40 g/mol. Its IUPAC name is N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide.
Molecular Properties
| Compound Name | N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
| PubChem CID | 79211900 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NC1CCCCNC1)C1CSc2ccccc21 |
| InChI | InChI=1S/C15H20N2OS/c18-15(17-11-5-3-4-8-16-9-11)13-10-19-14-7-2-1-6-12(13)14/h1-2,6-7,11,13,16H,3-5,8-10H2,(H,17,18) |
| InChIKey | JYLGGVPDPNLWRA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide?
The IUPAC name of N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide (CID 79211900) is N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide.
What is the SMILES notation for N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide?
The canonical SMILES for N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide is O=C(NC1CCCCNC1)C1CSc2ccccc21.
What is the InChIKey of N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide?
The InChIKey is JYLGGVPDPNLWRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2OS/c18-15(17-11-5-3-4-8-16-9-11)13-10-19-14-7-2-1-6-12(13)14/h1-2,6-7,11,13,16H,3-5,8-10H2,(H,17,18).
What are the key properties of N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide?
N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide has a molecular weight of 276.40 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide is sourced from PubChem (CID 79211900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).