C15H20N2OS — CID 79211900
N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 79211900) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79211900 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(azepan-3-yl)-2,3-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NC1CCCCNC1)C1CSc2ccccc21 |
| InChI | InChI=1S/C15H20N2OS/c18-15(17-11-5-3-4-8-16-9-11)13-10-19-14-7-2-1-6-12(13)14/h1-2,6-7,11,13,16H,3-5,8-10H2,(H,17,18) |
| InChIKey | JYLGGVPDPNLWRA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |