C15H20N2O — CID 112531038
N-piperidin-3-yl-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 112531038) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-piperidin-3-yl-2,3-dihydro-1H-indene-2-carboxamide.
| Compound Name | N-piperidin-3-yl-2,3-dihydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 112531038 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-piperidin-3-yl-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | O=C(NC1CCCNC1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H20N2O/c18-15(17-14-6-3-7-16-10-14)13-8-11-4-1-2-5-12(11)9-13/h1-2,4-5,13-14,16H,3,6-10H2,(H,17,18) |
| InChIKey | MVSAUQLTAGTGLX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |