C16H21Cl2N3O2 — CID 119424407
1-(2-chlorophenyl)-5-oxo-N-piperidin-3-ylpyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119424407) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-oxo-N-piperidin-3-ylpyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | 1-(2-chlorophenyl)-5-oxo-N-piperidin-3-ylpyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119424407 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-(2-chlorophenyl)-5-oxo-N-piperidin-3-ylpyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCNC1)C1CC(=O)N(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H20ClN3O2.ClH/c17-13-5-1-2-6-14(13)20-10-11(8-15(20)21)16(22)19-12-4-3-7-18-9-12;/h1-2,5-6,11-12,18H,3-4,7-10H2,(H,19,22);1H |
| InChIKey | SDOODKYPJRIPAK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |